CAS 2476-35-9 appears in our catalog under these names: 5–Bromo–2–methoxybenzoic acid, 5-Bromo-2-methoxybenzoic Acid, >98.0%(GC)(T), 5-Bromo-2-methoxybenzoic acid 98%, 5-Bromo-2-methoxybenzoic acid, 95%. Offered by: GLPBio, TCI, Ambeed, Fluorochem. Available pack sizes: 100g, 25g, 1g, 5g, 10g.
5-bromo-2-methoxybenzoic acid (CAS 2476-35-9) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: 5-bromo-2-methoxybenzoic acid. InChIKey: JFDUXZIRWBYBAQ-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | 5-bromo-2-methoxybenzoic acid |
| InChIKey | JFDUXZIRWBYBAQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Br)C(=O)O |
Computed by PubChem (NCBI)