Products 2225141-80-8
CAS 2225141-80-8 is the registry number for 2-(Aminomethyl)benzene-1,3,5-triol hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(aminomethyl)benzene-1,3,5-triol;hydrochloride (CAS 2225141-80-8) is a chemical compound with the molecular formula C7H10ClNO3 and a molecular weight of 191.61 g/mol. IUPAC name: 2-(aminomethyl)benzene-1,3,5-triol;hydrochloride. InChIKey: QEZLJLZCYJZWSK-UHFFFAOYSA-N.
| Molecular formula | C7H10ClNO3 |
|---|---|
| Molecular weight | 191.61 g/mol |
| IUPAC name | 2-(aminomethyl)benzene-1,3,5-triol;hydrochloride |
| InChIKey | QEZLJLZCYJZWSK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1O)CN)O)O.Cl |
Computed by PubChem (NCBI)