Products 2225141-86-4
CAS 2225141-86-4 is the registry number for 1H-Pyrazolo(3,4-b)pyridine-4-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid;hydrochloride (CAS 2225141-86-4) is a chemical compound with the molecular formula C7H6ClN3O2 and a molecular weight of 199.59 g/mol. IUPAC name: 1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid;hydrochloride. InChIKey: GRZIVYZYBDYUAG-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN3O2 |
|---|---|
| Molecular weight | 199.59 g/mol |
| IUPAC name | 1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid;hydrochloride |
| InChIKey | GRZIVYZYBDYUAG-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=C1C(=O)O)C=NN2.Cl |
Computed by PubChem (NCBI)