CAS 2225144-89-6 is the registry number for Methyl 2-amino-3-(4-hydroxy-3-methoxyphenyl)propanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 2-amino-3-(4-hydroxy-3-methoxyphenyl)propanoate;hydrochloride (CAS 2225144-89-6) is a chemical compound with the molecular formula C11H16ClNO4 and a molecular weight of 261.70 g/mol. IUPAC name: methyl 2-amino-3-(4-hydroxy-3-methoxyphenyl)propanoate;hydrochloride. InChIKey: PNUSXMBASIGORR-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO4 |
|---|---|
| Molecular weight | 261.70 g/mol |
| IUPAC name | methyl 2-amino-3-(4-hydroxy-3-methoxyphenyl)propanoate;hydrochloride |
| InChIKey | PNUSXMBASIGORR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)CC(C(=O)OC)N)O.Cl |
Computed by PubChem (NCBI)