Products 2225169-89-9
CAS 2225169-89-9 appears in our catalog under these names: 2–Methoxy–6–cyclopropylphenylboronic acid, (2-Cyclopropyl-6-methoxyphenyl)boronic acid, 98%, 98%, (2-Cyclopropyl-6-methoxyphenyl)boronic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 10mg, 25mg, 1g, 50mg, 100mg, 250mg.
(2-cyclopropyl-6-methoxyphenyl)boronic acid (CAS 2225169-89-9) is a chemical compound with the molecular formula C10H13BO3 and a molecular weight of 192.02 g/mol. IUPAC name: (2-cyclopropyl-6-methoxyphenyl)boronic acid. InChIKey: PZZIANTUMQMUSR-UHFFFAOYSA-N.
| Molecular formula | C10H13BO3 |
|---|---|
| Molecular weight | 192.02 g/mol |
| IUPAC name | (2-cyclopropyl-6-methoxyphenyl)boronic acid |
| InChIKey | PZZIANTUMQMUSR-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC=C1OC)C2CC2)(O)O |
Computed by PubChem (NCBI)