CAS 2225802-40-2 appears in our catalog under these names: 1-(Methyl-d3)-5-nitro-1H-indole, 97%, 1-Methyl-5-nitro-1H-indole-d3. Offered by: Combi-blocks, TRC. Available pack sizes: 5g, 1g, 10g, 500mg.
5-nitro-1-(trideuteriomethyl)indole (CAS 2225802-40-2) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 179.19 g/mol. IUPAC name: 5-nitro-1-(trideuteriomethyl)indole. InChIKey: PXBQSCHRKSBGKV-FIBGUPNXSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 179.19 g/mol |
| IUPAC name | 5-nitro-1-(trideuteriomethyl)indole |
| InChIKey | PXBQSCHRKSBGKV-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C=CC2=C1C=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)