Products 2225896-40-0
CAS 2225896-40-0 is the registry number for (βS)-β-Cyclopropyl-3-(phenylmethoxy)benzenepropanoic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(3S)-3-cyclopropyl-3-(3-phenylmethoxyphenyl)propanoic acid (CAS 2225896-40-0) is a chemical compound with the molecular formula C19H20O3 and a molecular weight of 296.4 g/mol. IUPAC name: (3S)-3-cyclopropyl-3-(3-phenylmethoxyphenyl)propanoic acid. InChIKey: PGJKHMFHIKRGGT-SFHVURJKSA-N.
| Molecular formula | C19H20O3 |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | (3S)-3-cyclopropyl-3-(3-phenylmethoxyphenyl)propanoic acid |
| InChIKey | PGJKHMFHIKRGGT-SFHVURJKSA-N |
| SMILES | C1CC1[C@H](CC(=O)O)C2=CC(=CC=C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)