CAS 2227197-47-7 is the registry number for Oxalic acid bis(tert-butyl n-[(3r,4s)-4-methoxypiperidin-3-yl]carbamate), 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
Bis(tert-butyl N-[(3R,4S)-4-methoxypiperidin-3-yl]carbamate);oxalic acid (CAS 2227197-47-7) is a chemical compound with the molecular formula C24H46N4O10 and a molecular weight of 550.6 g/mol. IUPAC name: bis(tert-butyl N-[(3R,4S)-4-methoxypiperidin-3-yl]carbamate);oxalic acid. InChIKey: HMGRHEKFNXWMHP-KAVFMPKWSA-N.
| Molecular formula | C24H46N4O10 |
|---|---|
| Molecular weight | 550.6 g/mol |
| IUPAC name | bis(tert-butyl N-[(3R,4S)-4-methoxypiperidin-3-yl]carbamate);oxalic acid |
| InChIKey | HMGRHEKFNXWMHP-KAVFMPKWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CNCC[C@@H]1OC.CC(C)(C)OC(=O)N[C@@H]1CNCC[C@@H]1OC.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)