CAS 2306245-65-6 is the registry number for tert-Butyl n-[(3s,4s)-4-methoxy-3-piperidyl]carbamate hemioxalate, 97%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Bis(tert-butyl N-[(3S,4S)-4-methoxypiperidin-3-yl]carbamate);oxalic acid (CAS 2306245-65-6) is a chemical compound with the molecular formula C24H46N4O10 and a molecular weight of 550.6 g/mol. IUPAC name: bis(tert-butyl N-[(3S,4S)-4-methoxypiperidin-3-yl]carbamate);oxalic acid. InChIKey: HMGRHEKFNXWMHP-LVAJUWGCSA-N.
| Molecular formula | C24H46N4O10 |
|---|---|
| Molecular weight | 550.6 g/mol |
| IUPAC name | bis(tert-butyl N-[(3S,4S)-4-methoxypiperidin-3-yl]carbamate);oxalic acid |
| InChIKey | HMGRHEKFNXWMHP-LVAJUWGCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CNCC[C@@H]1OC.CC(C)(C)OC(=O)N[C@H]1CNCC[C@@H]1OC.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)