CAS 2306248-51-9 is the registry number for tert-Butyl n-((3s,4r)-3-methoxy-4-piperidyl)carbamate,oxalic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g, 100mg, 5g, 10g.
Bis(tert-butyl N-[(3S,4R)-3-methoxypiperidin-4-yl]carbamate);oxalic acid (CAS 2306248-51-9) is a chemical compound with the molecular formula C24H46N4O10 and a molecular weight of 550.6 g/mol. IUPAC name: bis(tert-butyl N-[(3S,4R)-3-methoxypiperidin-4-yl]carbamate);oxalic acid. InChIKey: KBOMHWIBSAZVOI-KAVFMPKWSA-N.
| Molecular formula | C24H46N4O10 |
|---|---|
| Molecular weight | 550.6 g/mol |
| IUPAC name | bis(tert-butyl N-[(3S,4R)-3-methoxypiperidin-4-yl]carbamate);oxalic acid |
| InChIKey | KBOMHWIBSAZVOI-KAVFMPKWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCNC[C@@H]1OC.CC(C)(C)OC(=O)N[C@@H]1CCNC[C@@H]1OC.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)