Products 2306255-53-6

CAS 2306255-53-6 is the registry number for tert-Butyl ((3S,4R)-4-methoxypiperidin-3-yl)carbamate hemioxalate, 98%. Offered by: AmBeed. Available pack sizes: 5g, 1g.

Bis(tert-butyl N-[(3S,4R)-4-methoxypiperidin-3-yl]carbamate);oxalic acid (CAS 2306255-53-6) is a chemical compound with the molecular formula C24H46N4O10 and a molecular weight of 550.6 g/mol. IUPAC name: bis(tert-butyl N-[(3S,4R)-4-methoxypiperidin-3-yl]carbamate);oxalic acid. InChIKey: HMGRHEKFNXWMHP-FKXFVUDVSA-N.

Identity
Molecular formulaC24H46N4O10
Molecular weight550.6 g/mol
IUPAC namebis(tert-butyl N-[(3S,4R)-4-methoxypiperidin-3-yl]carbamate);oxalic acid
InChIKeyHMGRHEKFNXWMHP-FKXFVUDVSA-N
SMILESCC(C)(C)OC(=O)N[C@H]1CNCC[C@H]1OC.CC(C)(C)OC(=O)N[C@H]1CNCC[C@H]1OC.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)