Products 2253105-08-5

CAS 2253105-08-5 is the registry number for tert-butyl N-[(3R,4S)-3-methoxy-4-piperidyl]carbamate,hemi(oxalic acid), 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

Bis(tert-butyl N-[(3R,4S)-3-methoxypiperidin-4-yl]carbamate);oxalic acid (CAS 2253105-08-5) is a chemical compound with the molecular formula C24H46N4O10 and a molecular weight of 550.6 g/mol. IUPAC name: bis(tert-butyl N-[(3R,4S)-3-methoxypiperidin-4-yl]carbamate);oxalic acid. InChIKey: KBOMHWIBSAZVOI-FKXFVUDVSA-N.

Identity
Molecular formulaC24H46N4O10
Molecular weight550.6 g/mol
IUPAC namebis(tert-butyl N-[(3R,4S)-3-methoxypiperidin-4-yl]carbamate);oxalic acid
InChIKeyKBOMHWIBSAZVOI-FKXFVUDVSA-N
SMILESCC(C)(C)OC(=O)N[C@H]1CCNC[C@H]1OC.CC(C)(C)OC(=O)N[C@H]1CCNC[C@H]1OC.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)