CAS 2253105-33-6 appears in our catalog under these names: tert-Butyl n-[(3s,4s)-3-methoxypiperidin-4-yl]carbamate hemioxalate, 95%, OXALIC ACID, BIS(TERT-BUTYL N-((3S,4S)-3-METHOXYPIPERIDIN-4-YL)CARBAMATE), 97%, tert-butyl N-[(3S,4S)-3-methoxypiperidin-4-yl]carbamate hemioxalate, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg, 500mg.
Bis(tert-butyl N-[(3S,4S)-3-methoxypiperidin-4-yl]carbamate);oxalic acid (CAS 2253105-33-6) is a chemical compound with the molecular formula C24H46N4O10 and a molecular weight of 550.6 g/mol. IUPAC name: bis(tert-butyl N-[(3S,4S)-3-methoxypiperidin-4-yl]carbamate);oxalic acid. InChIKey: KBOMHWIBSAZVOI-LVAJUWGCSA-N.
| Molecular formula | C24H46N4O10 |
|---|---|
| Molecular weight | 550.6 g/mol |
| IUPAC name | bis(tert-butyl N-[(3S,4S)-3-methoxypiperidin-4-yl]carbamate);oxalic acid |
| InChIKey | KBOMHWIBSAZVOI-LVAJUWGCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCNC[C@@H]1OC.CC(C)(C)OC(=O)N[C@H]1CCNC[C@@H]1OC.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)