CAS 2227198-96-9 appears in our catalog under these names: (5R)-5-Phenylmorpholin-2-one hydrochloride, 95%, (R)-5-Phenylmorpholin-2-one hydrochloride, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
(5R)-5-phenylmorpholin-2-one;hydrochloride (CAS 2227198-96-9) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: (5R)-5-phenylmorpholin-2-one;hydrochloride. InChIKey: QAUUHFOYPUBYQU-FVGYRXGTSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | (5R)-5-phenylmorpholin-2-one;hydrochloride |
| InChIKey | QAUUHFOYPUBYQU-FVGYRXGTSA-N |
| SMILES | C1[C@H](NCC(=O)O1)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)