CAS 22275-34-9 is the registry number for 5-Phenylbarbituric Acid. Offered by: TRC. Available pack sizes: 250mg, 25mg.
5-phenyl-1,3-diazinane-2,4,6-trione (CAS 22275-34-9) is a chemical compound with the molecular formula C10H8N2O3 and a molecular weight of 204.18 g/mol. IUPAC name: 5-phenyl-1,3-diazinane-2,4,6-trione. InChIKey: HTEHILLCBQWTLP-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O3 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 5-phenyl-1,3-diazinane-2,4,6-trione |
| InChIKey | HTEHILLCBQWTLP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2C(=O)NC(=O)NC2=O |
Computed by PubChem (NCBI)