CAS 22276-16-0 is the registry number for 3,4-Dichloro-N-hydroxybenzimidamide, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3,4-dichloro-N'-hydroxybenzenecarboximidamide (CAS 22276-16-0) is a chemical compound with the molecular formula C7H6Cl2N2O and a molecular weight of 205.04 g/mol. IUPAC name: 3,4-dichloro-N'-hydroxybenzenecarboximidamide. InChIKey: IJWZEFKKFRYHKP-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2O |
|---|---|
| Molecular weight | 205.04 g/mol |
| IUPAC name | 3,4-dichloro-N'-hydroxybenzenecarboximidamide |
| InChIKey | IJWZEFKKFRYHKP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1/C(=N/O)/N)Cl)Cl |
Computed by PubChem (NCBI)