Products 2227705-75-9
CAS 2227705-75-9 is the registry number for rac-(3R,4R)-3-Fluoro-4-phenylpyrrolidine hydrochloride. Offered by: Biosynth. Available pack sizes: 25mg, 0,25g.
(3S,4S)-3-fluoro-4-phenylpyrrolidine;hydrochloride (CAS 2227705-75-9) is a chemical compound with the molecular formula C10H13ClFN and a molecular weight of 201.67 g/mol. IUPAC name: (3S,4S)-3-fluoro-4-phenylpyrrolidine;hydrochloride. InChIKey: GIZSGVXLLJKWCI-DHTOPLTISA-N.
| Molecular formula | C10H13ClFN |
|---|---|
| Molecular weight | 201.67 g/mol |
| IUPAC name | (3S,4S)-3-fluoro-4-phenylpyrrolidine;hydrochloride |
| InChIKey | GIZSGVXLLJKWCI-DHTOPLTISA-N |
| SMILES | C1[C@@H]([C@@H](CN1)F)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)