Products 2229082-76-0
CAS 2229082-76-0 is the registry number for 4,4-Difluoro-3-(pyridin-2-yl)butanoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4,4-difluoro-3-pyridin-2-ylbutanoic acid (CAS 2229082-76-0) is a chemical compound with the molecular formula C9H9F2NO2 and a molecular weight of 201.17 g/mol. IUPAC name: 4,4-difluoro-3-pyridin-2-ylbutanoic acid. InChIKey: WTZZSMZAUTZOMG-UHFFFAOYSA-N.
| Molecular formula | C9H9F2NO2 |
|---|---|
| Molecular weight | 201.17 g/mol |
| IUPAC name | 4,4-difluoro-3-pyridin-2-ylbutanoic acid |
| InChIKey | WTZZSMZAUTZOMG-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C(CC(=O)O)C(F)F |
Computed by PubChem (NCBI)