CAS 2230975-05-8 is the registry number for 7-Chloro-3-(3,5-dimethoxyphenyl)-2-methyl-2,6-naphthyridin-1(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-chloro-3-(3,5-dimethoxyphenyl)-2-methyl-2,6-naphthyridin-1-one (CAS 2230975-05-8) is a chemical compound with the molecular formula C17H15ClN2O3 and a molecular weight of 330.8 g/mol. IUPAC name: 7-chloro-3-(3,5-dimethoxyphenyl)-2-methyl-2,6-naphthyridin-1-one. InChIKey: SQHGOWPWPCSFQW-UHFFFAOYSA-N.
| Molecular formula | C17H15ClN2O3 |
|---|---|
| Molecular weight | 330.8 g/mol |
| IUPAC name | 7-chloro-3-(3,5-dimethoxyphenyl)-2-methyl-2,6-naphthyridin-1-one |
| InChIKey | SQHGOWPWPCSFQW-UHFFFAOYSA-N |
| SMILES | CN1C(=CC2=CN=C(C=C2C1=O)Cl)C3=CC(=CC(=C3)OC)OC |
Computed by PubChem (NCBI)