Products 714953-84-1
CAS 714953-84-1 is the registry number for 1-[Amino-(4-nitro-phenyl)-methyl]-naphthalen-2-ol hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-[amino-(4-nitrophenyl)methyl]naphthalen-2-ol;hydrochloride (CAS 714953-84-1) is a chemical compound with the molecular formula C17H15ClN2O3 and a molecular weight of 330.8 g/mol. IUPAC name: 1-[amino-(4-nitrophenyl)methyl]naphthalen-2-ol;hydrochloride. InChIKey: PMQFOFOAHKGDFW-UHFFFAOYSA-N.
| Molecular formula | C17H15ClN2O3 |
|---|---|
| Molecular weight | 330.8 g/mol |
| IUPAC name | 1-[amino-(4-nitrophenyl)methyl]naphthalen-2-ol;hydrochloride |
| InChIKey | PMQFOFOAHKGDFW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2C(C3=CC=C(C=C3)[N+](=O)[O-])N)O.Cl |
Computed by PubChem (NCBI)