Products 558638-15-6
CAS 558638-15-6 is the registry number for Antibacterial agent 241. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-chloro-6-[4-(4-methoxyphenyl)-5-methyl-1H-pyrazol-3-yl]benzene-1,3-diol (CAS 558638-15-6) is a chemical compound with the molecular formula C17H15ClN2O3 and a molecular weight of 330.8 g/mol. IUPAC name: 4-chloro-6-[4-(4-methoxyphenyl)-5-methyl-1H-pyrazol-3-yl]benzene-1,3-diol. InChIKey: NOPCVCOFHGDYAB-UHFFFAOYSA-N.
| Molecular formula | C17H15ClN2O3 |
|---|---|
| Molecular weight | 330.8 g/mol |
| IUPAC name | 4-chloro-6-[4-(4-methoxyphenyl)-5-methyl-1H-pyrazol-3-yl]benzene-1,3-diol |
| InChIKey | NOPCVCOFHGDYAB-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C2=CC(=C(C=C2O)O)Cl)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)