CAS 474070-11-6 is the registry number for 4-Chloro-1-(3-chlorophenyl)-7,8-dimethoxy-5h-2,3-benzodiazepine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(3-chlorophenyl)-7,8-dimethoxy-3,5-dihydro-2,3-benzodiazepin-4-one (CAS 474070-11-6) is a chemical compound with the molecular formula C17H15ClN2O3 and a molecular weight of 330.8 g/mol. IUPAC name: 1-(3-chlorophenyl)-7,8-dimethoxy-3,5-dihydro-2,3-benzodiazepin-4-one. InChIKey: VNWHMPGNXVZAFW-UHFFFAOYSA-N.
| Molecular formula | C17H15ClN2O3 |
|---|---|
| Molecular weight | 330.8 g/mol |
| IUPAC name | 1-(3-chlorophenyl)-7,8-dimethoxy-3,5-dihydro-2,3-benzodiazepin-4-one |
| InChIKey | VNWHMPGNXVZAFW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)CC(=O)NN=C2C3=CC(=CC=C3)Cl)OC |
Computed by PubChem (NCBI)