CAS 864717-20-4 is the registry number for P5SA-2, 99.51%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 25 mg, 50 mg, 10 mg, 5 mg.
3-[(4-chlorophenyl)methyl]-5-(3,4-dimethoxyphenyl)-1,2,4-oxadiazole (CAS 864717-20-4) is a chemical compound with the molecular formula C17H15ClN2O3 and a molecular weight of 330.8 g/mol. IUPAC name: 3-[(4-chlorophenyl)methyl]-5-(3,4-dimethoxyphenyl)-1,2,4-oxadiazole. InChIKey: SXAMNHNOVZQXKL-UHFFFAOYSA-N.
| Molecular formula | C17H15ClN2O3 |
|---|---|
| Molecular weight | 330.8 g/mol |
| IUPAC name | 3-[(4-chlorophenyl)methyl]-5-(3,4-dimethoxyphenyl)-1,2,4-oxadiazole |
| InChIKey | SXAMNHNOVZQXKL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=NC(=NO2)CC3=CC=C(C=C3)Cl)OC |
Computed by PubChem (NCBI)