Products 864717-20-4

CAS 864717-20-4 is the registry number for P5SA-2, 99.51%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 25 mg, 50 mg, 10 mg, 5 mg.

Structural formula: {0} (CAS {1})

3-[(4-chlorophenyl)methyl]-5-(3,4-dimethoxyphenyl)-1,2,4-oxadiazole (CAS 864717-20-4) is a chemical compound with the molecular formula C17H15ClN2O3 and a molecular weight of 330.8 g/mol. IUPAC name: 3-[(4-chlorophenyl)methyl]-5-(3,4-dimethoxyphenyl)-1,2,4-oxadiazole. InChIKey: SXAMNHNOVZQXKL-UHFFFAOYSA-N.

Identity
Molecular formulaC17H15ClN2O3
Molecular weight330.8 g/mol
IUPAC name3-[(4-chlorophenyl)methyl]-5-(3,4-dimethoxyphenyl)-1,2,4-oxadiazole
InChIKeySXAMNHNOVZQXKL-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)C2=NC(=NO2)CC3=CC=C(C=C3)Cl)OC

Computed by PubChem (NCBI)