Products 421584-03-4
CAS 421584-03-4 is the registry number for 5-((4-Chloro-3-methylphenoxy)methyl)-3-(4-methoxyphenyl)-1,2,4-oxadiazole, ≥97%, ≥97%. Offered by: Chemat. Available pack sizes: 5mg, 25mg, 50mg, 100mg, 250mg.
5-[(4-chloro-3-methylphenoxy)methyl]-3-(4-methoxyphenyl)-1,2,4-oxadiazole (CAS 421584-03-4) is a chemical compound with the molecular formula C17H15ClN2O3 and a molecular weight of 330.8 g/mol. IUPAC name: 5-[(4-chloro-3-methylphenoxy)methyl]-3-(4-methoxyphenyl)-1,2,4-oxadiazole. InChIKey: KZBRCQVQYZVOAM-UHFFFAOYSA-N.
| Molecular formula | C17H15ClN2O3 |
|---|---|
| Molecular weight | 330.8 g/mol |
| IUPAC name | 5-[(4-chloro-3-methylphenoxy)methyl]-3-(4-methoxyphenyl)-1,2,4-oxadiazole |
| InChIKey | KZBRCQVQYZVOAM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OCC2=NC(=NO2)C3=CC=C(C=C3)OC)Cl |
Computed by PubChem (NCBI)