Products 223555-95-1
CAS 223555-95-1 appears in our catalog under these names: 3-(4-Bromophenyl)oxazolidin-2-one, 97%, 3-(4-BROMOPHENYL)-1,3-OXAZOLIDIN-2-ONE, 97%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg, 2.5g, 10g.
3-(4-bromophenyl)-1,3-oxazolidin-2-one (CAS 223555-95-1) is a chemical compound with the molecular formula C9H8BrNO2 and a molecular weight of 242.07 g/mol. IUPAC name: 3-(4-bromophenyl)-1,3-oxazolidin-2-one. InChIKey: FJGPGFCQWYNYPR-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO2 |
|---|---|
| Molecular weight | 242.07 g/mol |
| IUPAC name | 3-(4-bromophenyl)-1,3-oxazolidin-2-one |
| InChIKey | FJGPGFCQWYNYPR-UHFFFAOYSA-N |
| SMILES | C1COC(=O)N1C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)