CAS 22362-66-9 appears in our catalog under these names: 3',5'–Dibromo–2'–hydroxyacetophenone, 3',5'-Dibromo-2'-hydroxyacetophenone, 99% , 3',5'-Dibromo-2'-hydroxyacetophenone, 3',5'-Dibromo-2'-hydroxyacetophenone, >98.0%(GC)(T), 1-(3,5-Dibromo-2-hydroxyphenyl)ethanone 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI, Ambeed. Available pack sizes: 100g, 25g, 5g, 500g, 250g, 250mg, 1g, 10g.
1-(3,5-dibromo-2-hydroxyphenyl)ethanone (CAS 22362-66-9) is a chemical compound with the molecular formula C8H6Br2O2 and a molecular weight of 293.94 g/mol. IUPAC name: 1-(3,5-dibromo-2-hydroxyphenyl)ethanone. InChIKey: RCKHUOIKVIOMGZ-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O2 |
|---|---|
| Molecular weight | 293.94 g/mol |
| IUPAC name | 1-(3,5-dibromo-2-hydroxyphenyl)ethanone |
| InChIKey | RCKHUOIKVIOMGZ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=CC(=C1)Br)Br)O |
Computed by PubChem (NCBI)