Products 2241128-99-2
CAS 2241128-99-2 is the registry number for 4-(1-Aminocyclopropyl)-1λâ¶-thiane-1,1-dione hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(1,1-dioxothian-4-yl)cyclopropan-1-amine;hydrochloride (CAS 2241128-99-2) is a chemical compound with the molecular formula C8H16ClNO2S and a molecular weight of 225.74 g/mol. IUPAC name: 1-(1,1-dioxothian-4-yl)cyclopropan-1-amine;hydrochloride. InChIKey: LRAJBYAHAWKFSN-UHFFFAOYSA-N.
| Molecular formula | C8H16ClNO2S |
|---|---|
| Molecular weight | 225.74 g/mol |
| IUPAC name | 1-(1,1-dioxothian-4-yl)cyclopropan-1-amine;hydrochloride |
| InChIKey | LRAJBYAHAWKFSN-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCC1C2(CC2)N.Cl |
Computed by PubChem (NCBI)