Products 2241138-91-8
CAS 2241138-91-8 is the registry number for 1-(2,2-Difluoroethyl)piperidine-2-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(2,2-difluoroethyl)piperidine-2-carboxylic acid;hydrochloride (CAS 2241138-91-8) is a chemical compound with the molecular formula C8H14ClF2NO2 and a molecular weight of 229.65 g/mol. IUPAC name: 1-(2,2-difluoroethyl)piperidine-2-carboxylic acid;hydrochloride. InChIKey: ZPJFXRDIBRKYQL-UHFFFAOYSA-N.
| Molecular formula | C8H14ClF2NO2 |
|---|---|
| Molecular weight | 229.65 g/mol |
| IUPAC name | 1-(2,2-difluoroethyl)piperidine-2-carboxylic acid;hydrochloride |
| InChIKey | ZPJFXRDIBRKYQL-UHFFFAOYSA-N |
| SMILES | C1CCN(C(C1)C(=O)O)CC(F)F.Cl |
Computed by PubChem (NCBI)