Products 2241144-66-9
CAS 2241144-66-9 is the registry number for 1-(1,2,3,6-Tetrahydropyridin-4-yl)cyclobutane-1-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(1,2,3,6-tetrahydropyridin-4-yl)cyclobutane-1-carboxylic acid;hydrochloride (CAS 2241144-66-9) is a chemical compound with the molecular formula C10H16ClNO2 and a molecular weight of 217.69 g/mol. IUPAC name: 1-(1,2,3,6-tetrahydropyridin-4-yl)cyclobutane-1-carboxylic acid;hydrochloride. InChIKey: OMRVOTLZVBOJHM-UHFFFAOYSA-N.
| Molecular formula | C10H16ClNO2 |
|---|---|
| Molecular weight | 217.69 g/mol |
| IUPAC name | 1-(1,2,3,6-tetrahydropyridin-4-yl)cyclobutane-1-carboxylic acid;hydrochloride |
| InChIKey | OMRVOTLZVBOJHM-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=CCNCC2)C(=O)O.Cl |
Computed by PubChem (NCBI)