CAS 2241594-21-6 appears in our catalog under these names: (R)–2–(2,5–Dichlorophenyl)pyrrolidine hydrochloride, (R)-2-(2,5-Dichlorophenyl)pyrrolidine hydrochloride, 98%, 98%, (R)-2-(2,5-Dichlorophenyl)pyrrolidine hydrochloride, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
(2R)-2-(2,5-dichlorophenyl)pyrrolidine;hydrochloride (CAS 2241594-21-6) is a chemical compound with the molecular formula C10H12Cl3N and a molecular weight of 252.6 g/mol. IUPAC name: (2R)-2-(2,5-dichlorophenyl)pyrrolidine;hydrochloride. InChIKey: PFNXBLVMVXABHJ-HNCPQSOCSA-N.
| Molecular formula | C10H12Cl3N |
|---|---|
| Molecular weight | 252.6 g/mol |
| IUPAC name | (2R)-2-(2,5-dichlorophenyl)pyrrolidine;hydrochloride |
| InChIKey | PFNXBLVMVXABHJ-HNCPQSOCSA-N |
| SMILES | C1C[C@@H](NC1)C2=C(C=CC(=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)