Products 2307770-03-0
CAS 2307770-03-0 is the registry number for (S)-2-(2,5-Dichlorophenyl)pyrrolidine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(2S)-2-(2,5-dichlorophenyl)pyrrolidine;hydrochloride (CAS 2307770-03-0) is a chemical compound with the molecular formula C10H12Cl3N and a molecular weight of 252.6 g/mol. IUPAC name: (2S)-2-(2,5-dichlorophenyl)pyrrolidine;hydrochloride. InChIKey: PFNXBLVMVXABHJ-PPHPATTJSA-N.
| Molecular formula | C10H12Cl3N |
|---|---|
| Molecular weight | 252.6 g/mol |
| IUPAC name | (2S)-2-(2,5-dichlorophenyl)pyrrolidine;hydrochloride |
| InChIKey | PFNXBLVMVXABHJ-PPHPATTJSA-N |
| SMILES | C1C[C@H](NC1)C2=C(C=CC(=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)