CAS 2241870-47-1 is the registry number for (5–(propan–2–yl–d7)pyridin–3–yl–2,4,6–d3)boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[2,4,6-trideuterio-5-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-3-pyridinyl]boronic acid (CAS 2241870-47-1) is a chemical compound with the molecular formula C8H12BNO2 and a molecular weight of 175.06 g/mol. IUPAC name: [2,4,6-trideuterio-5-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-3-pyridinyl]boronic acid. InChIKey: UDEAILLWXQRGBU-ZGYYUIRESA-N.
| Molecular formula | C8H12BNO2 |
|---|---|
| Molecular weight | 175.06 g/mol |
| IUPAC name | [2,4,6-trideuterio-5-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-3-pyridinyl]boronic acid |
| InChIKey | UDEAILLWXQRGBU-ZGYYUIRESA-N |
| SMILES | [2H]C1=C(C(=NC(=C1C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])[2H])[2H])B(O)O |
Computed by PubChem (NCBI)