Products 2377611-15-7
CAS 2377611-15-7 appears in our catalog under these names: 4-Methyl-3-(methylamino)phenylboronic acid, 97%, (4-Methyl-3-(methylamino)phenyl)boronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg, 5g.
[4-methyl-3-(methylamino)phenyl]boronic acid (CAS 2377611-15-7) is a chemical compound with the molecular formula C8H12BNO2 and a molecular weight of 165.00 g/mol. IUPAC name: [4-methyl-3-(methylamino)phenyl]boronic acid. InChIKey: NNZUEWUVKXDSCP-UHFFFAOYSA-N.
| Molecular formula | C8H12BNO2 |
|---|---|
| Molecular weight | 165.00 g/mol |
| IUPAC name | [4-methyl-3-(methylamino)phenyl]boronic acid |
| InChIKey | NNZUEWUVKXDSCP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C)NC)(O)O |
Computed by PubChem (NCBI)