CAS 1627723-05-0 is the registry number for (4-Isopropylpyridin-3-yl)boronic acid, 98%. Offered by: AmBeed. Available pack sizes: 5g, 250mg, 1g.
(4-propan-2-yl-3-pyridinyl)boronic acid (CAS 1627723-05-0) is a chemical compound with the molecular formula C8H12BNO2 and a molecular weight of 165.00 g/mol. IUPAC name: (4-propan-2-yl-3-pyridinyl)boronic acid. InChIKey: LJGCSHWXODMAQM-UHFFFAOYSA-N.
| Molecular formula | C8H12BNO2 |
|---|---|
| Molecular weight | 165.00 g/mol |
| IUPAC name | (4-propan-2-yl-3-pyridinyl)boronic acid |
| InChIKey | LJGCSHWXODMAQM-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CN=C1)C(C)C)(O)O |
Computed by PubChem (NCBI)