CAS 2225155-96-2 is the registry number for (6–isopropylpyridin–3–yl)boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg.
(6-propan-2-yl-3-pyridinyl)boronic acid (CAS 2225155-96-2) is a chemical compound with the molecular formula C8H12BNO2 and a molecular weight of 165.00 g/mol. IUPAC name: (6-propan-2-yl-3-pyridinyl)boronic acid. InChIKey: BOEITCPLEOEZLF-UHFFFAOYSA-N.
| Molecular formula | C8H12BNO2 |
|---|---|
| Molecular weight | 165.00 g/mol |
| IUPAC name | (6-propan-2-yl-3-pyridinyl)boronic acid |
| InChIKey | BOEITCPLEOEZLF-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C=C1)C(C)C)(O)O |
Computed by PubChem (NCBI)