CAS 1788062-08-7 appears in our catalog under these names: (2–isopropylpyridin–4–yl)boronic acid, (2-Isopropylpyridin-4-yl)boronic acid, 95+%. Offered by: GLPBio, Fluorochem. Available pack sizes: 100mg, 25mg, 5mg.
(2-propan-2-yl-4-pyridinyl)boronic acid (CAS 1788062-08-7) is a chemical compound with the molecular formula C8H12BNO2 and a molecular weight of 165.00 g/mol. IUPAC name: (2-propan-2-yl-4-pyridinyl)boronic acid. InChIKey: DHMDAJOLNCYXNB-UHFFFAOYSA-N.
| Molecular formula | C8H12BNO2 |
|---|---|
| Molecular weight | 165.00 g/mol |
| IUPAC name | (2-propan-2-yl-4-pyridinyl)boronic acid |
| InChIKey | DHMDAJOLNCYXNB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC=C1)C(C)C)(O)O |
Computed by PubChem (NCBI)