CAS 28611-39-4 appears in our catalog under these names: 4-(Dimethylamino)phenylboronic acid, 4-Dimethylaminophenylboronic acid, 98%, 4-(Dimethylamino)phenylboronic acid, 98%, 4-(N,N-Dimethylamino)phenylboronic acid, 96%, (4-(dimethylamino)phenyl)boronic acid, 98%, 98%. Offered by: Biosynth, Fluorochem, Ambeed, Thermo Scientific (Acros), Chemat. Available pack sizes: 25g, 250mg, 1g, 5g, 10g, 100g, 2.5g, 500MG.
[4-(dimethylamino)phenyl]boronic acid (CAS 28611-39-4) is a chemical compound with the molecular formula C8H12BNO2 and a molecular weight of 165.00 g/mol. IUPAC name: [4-(dimethylamino)phenyl]boronic acid. InChIKey: RIIPFHVHLXPMHQ-UHFFFAOYSA-N.
| Molecular formula | C8H12BNO2 |
|---|---|
| Molecular weight | 165.00 g/mol |
| IUPAC name | [4-(dimethylamino)phenyl]boronic acid |
| InChIKey | RIIPFHVHLXPMHQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)N(C)C)(O)O |
Computed by PubChem (NCBI)