CAS 22422-19-1 is the registry number for Dapoxetine Impurity 59. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-1-(2,5-dimethylphenyl)propan-1-one (CAS 22422-19-1) is a chemical compound with the molecular formula C11H13ClO and a molecular weight of 196.67 g/mol. IUPAC name: 3-chloro-1-(2,5-dimethylphenyl)propan-1-one. InChIKey: VAEZTAPZMZMJMT-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO |
|---|---|
| Molecular weight | 196.67 g/mol |
| IUPAC name | 3-chloro-1-(2,5-dimethylphenyl)propan-1-one |
| InChIKey | VAEZTAPZMZMJMT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)C(=O)CCCl |
Computed by PubChem (NCBI)