Products 2243490-61-9
CAS 2243490-61-9 is the registry number for 2-(tert-Butyl) 3-ethyl (1R,3S,5S)-5-formyl-2-azabicyclo[3.1.0]hexane-2,3-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-O-tert-butyl 3-O-ethyl (1R,3S,5S)-5-formyl-2-azabicyclo[3.1.0]hexane-2,3-dicarboxylate (CAS 2243490-61-9) is a chemical compound with the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. IUPAC name: 2-O-tert-butyl 3-O-ethyl (1R,3S,5S)-5-formyl-2-azabicyclo[3.1.0]hexane-2,3-dicarboxylate. InChIKey: AHZUZEJTEXUOHW-RBZYPMLTSA-N.
| Molecular formula | C14H21NO5 |
|---|---|
| Molecular weight | 283.32 g/mol |
| IUPAC name | 2-O-tert-butyl 3-O-ethyl (1R,3S,5S)-5-formyl-2-azabicyclo[3.1.0]hexane-2,3-dicarboxylate |
| InChIKey | AHZUZEJTEXUOHW-RBZYPMLTSA-N |
| SMILES | CCOC(=O)[C@@H]1C[C@]2(C[C@H]2N1C(=O)OC(C)(C)C)C=O |
Computed by PubChem (NCBI)