CAS 1422462-67-6 appears in our catalog under these names: (Z)-tert-Butyl 3-(2-ethoxy-2-oxoethylidene)-4-oxopiperidine-1-carboxylate, 95%, (Z)-tert-Butyl 3-(2-Ethoxy-2-oxoethylidene)-4-oxopiperidine-1-carboxylate. Offered by: Combi-blocks, TRC. Available pack sizes: 250mg, 1g.
Tert-butyl (3Z)-3-(2-ethoxy-2-oxoethylidene)-4-oxopiperidine-1-carboxylate (CAS 1422462-67-6) is a chemical compound with the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. IUPAC name: tert-butyl (3Z)-3-(2-ethoxy-2-oxoethylidene)-4-oxopiperidine-1-carboxylate. InChIKey: OBTPHGMAUQDRTM-NTMALXAHSA-N.
| Molecular formula | C14H21NO5 |
|---|---|
| Molecular weight | 283.32 g/mol |
| IUPAC name | tert-butyl (3Z)-3-(2-ethoxy-2-oxoethylidene)-4-oxopiperidine-1-carboxylate |
| InChIKey | OBTPHGMAUQDRTM-NTMALXAHSA-N |
| SMILES | CCOC(=O)/C=C\1/CN(CCC1=O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)