CAS 1076200-09-3 is the registry number for 1-Acetyl-2,2,5,5-tetramethyl-2,5-dihydro-1H-pyrrole-3-carboxylic (ethyl carbonic) anhydride, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethoxycarbonyl 1-acetyl-2,2,5,5-tetramethylpyrrole-3-carboxylate (CAS 1076200-09-3) is a chemical compound with the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. IUPAC name: ethoxycarbonyl 1-acetyl-2,2,5,5-tetramethylpyrrole-3-carboxylate. InChIKey: GWMKXLZHMWOKTQ-UHFFFAOYSA-N.
| Molecular formula | C14H21NO5 |
|---|---|
| Molecular weight | 283.32 g/mol |
| IUPAC name | ethoxycarbonyl 1-acetyl-2,2,5,5-tetramethylpyrrole-3-carboxylate |
| InChIKey | GWMKXLZHMWOKTQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)OC(=O)C1=CC(N(C1(C)C)C(=O)C)(C)C |
Computed by PubChem (NCBI)