Products 2677041-64-2
CAS 2677041-64-2 is the registry number for 6-(tert-Butyl) 3-methyl (1S,5S)-4-oxo-6-azabicyclo[3.2.1]octane-3,6-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-O-tert-butyl 3-O-methyl (1S,5S)-4-oxo-6-azabicyclo[3.2.1]octane-3,6-dicarboxylate (CAS 2677041-64-2) is a chemical compound with the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. IUPAC name: 6-O-tert-butyl 3-O-methyl (1S,5S)-4-oxo-6-azabicyclo[3.2.1]octane-3,6-dicarboxylate. InChIKey: QUVIVPMLCHTAHW-SMILAEQMSA-N.
| Molecular formula | C14H21NO5 |
|---|---|
| Molecular weight | 283.32 g/mol |
| IUPAC name | 6-O-tert-butyl 3-O-methyl (1S,5S)-4-oxo-6-azabicyclo[3.2.1]octane-3,6-dicarboxylate |
| InChIKey | QUVIVPMLCHTAHW-SMILAEQMSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2C[C@H]1C(=O)C(C2)C(=O)OC |
Computed by PubChem (NCBI)