Products 1189659-07-1
CAS 1189659-07-1 is the registry number for N-tert-Boc-2-(4-hydroxy-2-methoxyphenoxy)ethylamine-d3. Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
Tert-butyl N-[2-[4-hydroxy-2-(trideuteriomethoxy)phenoxy]ethyl]carbamate (CAS 1189659-07-1) is a chemical compound with the molecular formula C14H21NO5 and a molecular weight of 286.34 g/mol. IUPAC name: tert-butyl N-[2-[4-hydroxy-2-(trideuteriomethoxy)phenoxy]ethyl]carbamate. InChIKey: NRRQFYQWGDXZST-GKOSEXJESA-N.
| Molecular formula | C14H21NO5 |
|---|---|
| Molecular weight | 286.34 g/mol |
| IUPAC name | tert-butyl N-[2-[4-hydroxy-2-(trideuteriomethoxy)phenoxy]ethyl]carbamate |
| InChIKey | NRRQFYQWGDXZST-GKOSEXJESA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=CC(=C1)O)OCCNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)