CAS 1140321-06-7 appears in our catalog under these names: 8-tert-Butyl 2-methyl 3-oxo-8-azabicyclo(3.2.1)octane-2,8-dicarboxylate, 97%, O8-tert-butyl O2-methyl 3-oxo-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate, 96%, 96%, 8-(tert-Butyl) 2-methyl 3-oxo-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate, 96%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 100mg, 250mg, 500mg, 1g.
8-O-tert-butyl 2-O-methyl 3-oxo-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate (CAS 1140321-06-7) is a chemical compound with the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. IUPAC name: 8-O-tert-butyl 2-O-methyl 3-oxo-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate. InChIKey: KLRZSGVNONCIIT-UHFFFAOYSA-N.
| Molecular formula | C14H21NO5 |
|---|---|
| Molecular weight | 283.32 g/mol |
| IUPAC name | 8-O-tert-butyl 2-O-methyl 3-oxo-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate |
| InChIKey | KLRZSGVNONCIIT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1C(C(=O)C2)C(=O)OC |
Computed by PubChem (NCBI)