Products 228573-75-9

CAS 228573-75-9 is the registry number for 8-N-Boc 2-oxo-8-azabicyclo[3.2.1]octane-6-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

8-O-tert-butyl 6-O-methyl 2-oxo-8-azabicyclo[3.2.1]octane-6,8-dicarboxylate (CAS 228573-75-9) is a chemical compound with the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. IUPAC name: 8-O-tert-butyl 6-O-methyl 2-oxo-8-azabicyclo[3.2.1]octane-6,8-dicarboxylate. InChIKey: QOQYWBMVVBXIND-UHFFFAOYSA-N.

Identity
Molecular formulaC14H21NO5
Molecular weight283.32 g/mol
IUPAC name8-O-tert-butyl 6-O-methyl 2-oxo-8-azabicyclo[3.2.1]octane-6,8-dicarboxylate
InChIKeyQOQYWBMVVBXIND-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1C2CCC(=O)C1CC2C(=O)OC

Computed by PubChem (NCBI)