CAS 2243501-43-9 appears in our catalog under these names: (R)-4-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-hydroxybutanoic acid, 95%, (3R)-4-({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)-3-hydroxybutanoic acid. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 0,05g, 0,5g, 1g.
(3R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxybutanoic acid (CAS 2243501-43-9) is a chemical compound with the molecular formula C19H19NO5 and a molecular weight of 341.4 g/mol. IUPAC name: (3R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxybutanoic acid. InChIKey: KAVHFNYDXGWPBX-GFCCVEGCSA-N.
| Molecular formula | C19H19NO5 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | (3R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxybutanoic acid |
| InChIKey | KAVHFNYDXGWPBX-GFCCVEGCSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC[C@@H](CC(=O)O)O |
Computed by PubChem (NCBI)