Products 2243501-50-8
CAS 2243501-50-8 is the registry number for (4R)-4-Amino-3,4-dihydro-2H-1-benzopyran-6-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(4R)-4-amino-3,4-dihydro-2H-chromen-6-ol;hydrochloride (CAS 2243501-50-8) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: (4R)-4-amino-3,4-dihydro-2H-chromen-6-ol;hydrochloride. InChIKey: VZHYSHIRJPLOCF-DDWIOCJRSA-N.
| Molecular formula | C9H12ClNO2 |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | (4R)-4-amino-3,4-dihydro-2H-chromen-6-ol;hydrochloride |
| InChIKey | VZHYSHIRJPLOCF-DDWIOCJRSA-N |
| SMILES | C1COC2=C([C@@H]1N)C=C(C=C2)O.Cl |
Computed by PubChem (NCBI)