CAS 2243514-44-3 is the registry number for Methyl 2-hydroxy-1,8-naphthyridine-4-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 2-oxo-1H-1,8-naphthyridine-4-carboxylate (CAS 2243514-44-3) is a chemical compound with the molecular formula C10H8N2O3 and a molecular weight of 204.18 g/mol. IUPAC name: methyl 2-oxo-1H-1,8-naphthyridine-4-carboxylate. InChIKey: XGMVSKZUZUTRSB-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O3 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | methyl 2-oxo-1H-1,8-naphthyridine-4-carboxylate |
| InChIKey | XGMVSKZUZUTRSB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=O)NC2=C1C=CC=N2 |
Computed by PubChem (NCBI)