Products 2245166-81-6
CAS 2245166-81-6 is the registry number for Methyl 5,6-difluoro-2,3-dihydro-1H-indene-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5,6-difluoro-2,3-dihydro-1H-indene-2-carboxylate (CAS 2245166-81-6) is a chemical compound with the molecular formula C11H10F2O2 and a molecular weight of 212.19 g/mol. IUPAC name: methyl 5,6-difluoro-2,3-dihydro-1H-indene-2-carboxylate. InChIKey: OIEFCCYZRGWWDV-UHFFFAOYSA-N.
| Molecular formula | C11H10F2O2 |
|---|---|
| Molecular weight | 212.19 g/mol |
| IUPAC name | methyl 5,6-difluoro-2,3-dihydro-1H-indene-2-carboxylate |
| InChIKey | OIEFCCYZRGWWDV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC2=CC(=C(C=C2C1)F)F |
Computed by PubChem (NCBI)