Products 2246523-44-2
CAS 2246523-44-2 is the registry number for (4-((3-Methylbutan-2-yl)oxy)phenyl)boronic acid, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 50mg, 100mg, 250mg, 1g.
[4-(3-methylbutan-2-yloxy)phenyl]boronic acid (CAS 2246523-44-2) is a chemical compound with the molecular formula C11H17BO3 and a molecular weight of 208.06 g/mol. IUPAC name: [4-(3-methylbutan-2-yloxy)phenyl]boronic acid. InChIKey: FQMHHZKTKBQQOT-UHFFFAOYSA-N.
| Molecular formula | C11H17BO3 |
|---|---|
| Molecular weight | 208.06 g/mol |
| IUPAC name | [4-(3-methylbutan-2-yloxy)phenyl]boronic acid |
| InChIKey | FQMHHZKTKBQQOT-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OC(C)C(C)C)(O)O |
Computed by PubChem (NCBI)